| CAS Number | 37759-72-1 |
| Catalog Number | AG01DWE1(AGN-PC-0O9I35) |
| Chemical Name | (E)-4-Fluorobut-2-enoic acid |
| IUPAC Name | 4-fluorobut-2-enoic acid |
| InChI | InChI=1S/C4H5FO2/c5-3-1-2-4(6)7/h1-2H,3H2,(H,6,7) |
| InChI Key | VLPAEVHYNQOJRT-UHFFFAOYSA-N |
| MDL Number | MFCD19229088 |
| Molecular Formula | C4H5FO2 |
| Molecular Weight | 104.0797 |
| SMILES | C(/C=C/C(=O)O)F |
| Synonyms | (2E)-4-fluorobut-2-enoic acid, E,
37759-72-1,
|
| Complexity | 87.7 |
| Compound Is Canonicalized | Yes |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 104.027g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 7 |
| Hydrogen Bond Acceptor Count | 3 |
| Hydrogen Bond Donor Count | 1 |
| Isotope Atom Count | 0 |
| Molecular Weight | 104.08g/mol |
| Monoisotopic Mass | 104.027g/mol |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 37.3A^2 |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 1 |
| XLogP3 | 0.4 |
GHS Hazard and Precautionary Statements
Certificate of Analysis
Lot Number