| CAS Number | 1632070-89-3 |
| Catalog Number | AG00HYV3 |
| Chemical Name | Potassium trifluoro(naphthalen-2-ylmethyl)borate |
| IUPAC Name | potassium;trifluoro(naphthalen-2-ylmethyl)boranuide |
| InChI | InChI=1S/C11H9BF3.K/c13-12(14,15)8-9-5-6-10-3-1-2-4-11(10)7-9;/h1-7H,8H2;/q-1;+1 |
| InChI Key | HMGVKBWSWGTEGU-UHFFFAOYSA-N |
| MDL Number | MFCD28369609 |
| Molecular Formula | C11H9BF3K |
| Molecular Weight | 248.0937 |
| SMILES | F[B-](F)(F)CC1=CC=C2C=CC=CC2=C1.[K+] |
| Synonyms | Potassium trifluoro(naphthalen-2-ylmethyl)borate,
1632070-89-3,
|
| Complexity | 220 |
| Compound Is Canonicalized | Yes |
| Covalently-Bonded Unit Count | 2 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 248.039g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 16 |
| Hydrogen Bond Acceptor Count | 4 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Molecular Weight | 248.097g/mol |
| Monoisotopic Mass | 248.039g/mol |
| Rotatable Bond Count | 1 |
| Topological Polar Surface Area | 0A^2 |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
GHS Hazard and Precautionary Statements
| Symbol: | |
|
Hazard statements
|
|
|
Precuationary statements
|
|
|
Siginal words
|
|
Certificate of Analysis
Lot Number