| CAS Number | 33002-26-5 |
| Catalog Number | AG00CMYW(AGN-PC-0R8FRB) |
| Chemical Name | ethyl 2-Methyl-3-(triMethylsilyl)cycloprop-2-enecarboxylate |
| IUPAC Name | ethyl 2-methyl-3-trimethylsilylcycloprop-2-ene-1-carboxylate |
| InChI | InChI=1S/C10H18O2Si/c1-6-12-10(11)8-7(2)9(8)13(3,4)5/h8H,6H2,1-5H3 |
| InChI Key | BGBMQGQGKNVNPV-UHFFFAOYSA-N |
| MDL Number | MFCD27997611 |
| Molecular Formula | C10H18O2Si |
| Molecular Weight | 198.3342 |
| SMILES | CCOC(C1C([Si](C)(C)C)=C1C)=O |
| Synonyms | 33002-26-5,
ethyl 2-methyl-3-(trimethylsilyl)cycloprop-2-ene-1-carboxylate,
ethyl 2-Methyl-3-(triMethylsilyl)cycloprop-2-enecarboxylate,
2-(Trimethylsilyl)-3-methyl-2-cyclopropene-1-carboxylic acid ethyl ester,
CID11183231,
Ethyl 2-methyl-3-trimethylsilyl-cycloprop-2-ene-1-carboxylate,
|
| Complexity | 261 |
| Compound Is Canonicalized | Yes |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 198.108g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 13 |
| Hydrogen Bond Acceptor Count | 2 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Molecular Weight | 198.337g/mol |
| Monoisotopic Mass | 198.108g/mol |
| Rotatable Bond Count | 4 |
| Topological Polar Surface Area | 26.3A^2 |
| Undefined Atom Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
GHS Hazard and Precautionary Statements
Certificate of Analysis
Lot Number